CAS 109333-34-8
:1,2,3,7,8-PENTABROMODIBENZO-P-DIOXIN
Description:
1,2,3,7,8-Pentabromodibenzo-p-dioxin (CAS 109333-34-8) is a polybrominated aromatic compound that belongs to the class of dioxins, specifically characterized by the presence of five bromine atoms substituted on the dibenzo-p-dioxin structure. This compound is known for its persistence in the environment and potential bioaccumulation in living organisms. Its chemical structure contributes to its stability and resistance to degradation, making it a concern in environmental chemistry and toxicology. 1,2,3,7,8-Pentabromodibenzo-p-dioxin is often studied for its potential health effects, including endocrine disruption and carcinogenicity, although specific toxicity profiles can vary. It is typically found in industrial applications, particularly in flame retardants, and can be released into the environment through various pathways, including waste incineration and industrial processes. Regulatory agencies monitor its presence due to its environmental impact and potential risks to human health, emphasizing the need for careful management and assessment of such persistent organic pollutants.
Formula:C12H3Br5O2
InChI:InChI=1/C12H3Br5O2/c13-4-1-7-8(2-5(4)14)19-12-9(18-7)3-6(15)10(16)11(12)17/h1-3H
InChI key:InChIKey=ZIFMQFDZODRVTG-UHFFFAOYSA-N
SMILES:BrC1=C2C(OC=3C(O2)=CC(Br)=C(Br)C3)=CC(Br)=C1Br
Synonyms:- 1,2,3,7,8-Pentabromodibenzo-Para-Dioxin
- 1,2,3,7,8-Pentabromodibenzo[b,e][1,4]dioxin
- 1,2,3,7,8-Pentabromodibenzodioxin
- 1,2,3,7,8-Pentabromooxanthrene
- 1,2,3,7,8-Pentbromodibenzo-p-dioxin
- Dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentabromo-
- 1,2,3,7,8-Pentabromodibenzo(p)dioxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.