CAS 109333-35-9
:1,2,4,7,8-pentabromooxanthrene
Description:
1,2,4,7,8-Pentabromooxanthrene is a brominated organic compound characterized by its complex structure, which includes a fused aromatic system with multiple bromine substituents. This compound is part of the oxanthrene family, featuring a central oxanthrene core that is heavily brominated at specific positions, which significantly influences its chemical properties. The presence of bromine atoms enhances its hydrophobicity and may impart flame-retardant characteristics. Additionally, the bromination can affect the compound's reactivity, stability, and potential applications in materials science and environmental chemistry. 1,2,4,7,8-Pentabromooxanthrene is of interest in studies related to persistent organic pollutants due to its potential environmental impact and bioaccumulation. Its CAS number, 109333-35-9, serves as a unique identifier for regulatory and safety assessments. As with many brominated compounds, it is essential to consider its toxicity and environmental behavior, particularly in aquatic systems, where it may pose risks to ecosystems.
Formula:C12H3Br5O2
InChI:InChI=1/C12H3Br5O2/c13-4-2-8-9(3-5(4)14)19-12-10(17)6(15)1-7(16)11(12)18-8/h1-3H
SMILES:c1c(c(c2c(c1Br)Oc1cc(c(cc1O2)Br)Br)Br)Br
Synonyms:- Dibenzo[B,E][1,4]Dioxin, 1,2,4,7,8-Pentabromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.