CymitQuimica logo

CAS 109345-94-0

:

5-METHOXY-PYRIDIN-3-OL

Description:
5-Methoxy-pyridin-3-ol, with the CAS number 109345-94-0, is an organic compound that features a pyridine ring substituted with a methoxy group and a hydroxyl group. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its potential biological activity. The methoxy group (-OCH3) enhances its lipophilicity, potentially influencing its solubility and reactivity. The hydroxyl group (-OH) can participate in hydrogen bonding, affecting the compound's interactions with other molecules and its overall polarity. 5-Methoxy-pyridin-3-ol may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in areas such as agrochemicals or pharmaceuticals. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or industrial applications.
Formula:C6H7NO2
InChI:InChI=1/C6H7NO2/c1-9-6-2-5(8)3-7-4-6/h2-4,8H,1H3
InChI key:BREMJULVLYFLTE-UHFFFAOYSA-N
SMILES:COc1cc(cnc1)O
Synonyms:
  • 3-Hydroxy-5-Methoxypyridine
  • 3-Pyridinol, 5-methoxy-
Found 5 products.