CAS 109346-85-2

4-Bromo-3-fluorobenzeneacetaldehyde

Description:

4-Bromo-3-fluorobenzeneacetaldehyde is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with an aldehyde functional group. The molecular structure features a bromine atom at the para position and a fluorine atom at the meta position relative to the aldehyde group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of halogens like bromine and fluorine can influence the compound's physical properties, such as boiling point and solubility, as well as its reactivity in organic synthesis. Additionally, 4-Bromo-3-fluorobenzeneacetaldehyde may have applications in pharmaceuticals, agrochemicals, and materials science, owing to its unique structural features that can be exploited in various chemical transformations.

Formula: C₈H₆BrFO

InChI: InChI=1S/C8H6BrFO/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,4-5H,3H2

InChI key: InChIKey=VZKQYFRDNISYRK-UHFFFAOYSA-N

SMILES: C(C=O)C1=CC(F)=C(Br)C=C1

Synonyms:

• (4-Bromo-3-fluorophenyl)acetaldehyde
• Benzeneacetaldehyde, 4-bromo-3-fluoro-
• 2-(4-Bromo-3-fluorophenyl)acetaldehyde
• 4-Bromo-3-fluorobenzeneacetaldehyde