
CAS 109346-96-5
:3,5-Dibromobenzeneacetaldehyde
Description:
3,5-Dibromobenzeneacetaldehyde is an organic compound characterized by the presence of a benzene ring substituted with two bromine atoms at the 3 and 5 positions, along with an aldehyde functional group attached to an acetyl side chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The bromine substituents enhance the compound's electrophilic character, making it useful in synthetic organic chemistry for the introduction of further functional groups. Additionally, 3,5-Dibromobenzeneacetaldehyde may exhibit biological activity, which could be of interest in pharmaceutical research. Its solubility in organic solvents and limited solubility in water are typical for halogenated aromatic compounds. Safety precautions should be taken when handling this substance, as brominated compounds can pose health risks.
Formula:C8H6Br2O
InChI:InChI=1S/C8H6Br2O/c9-7-3-6(1-2-11)4-8(10)5-7/h2-5H,1H2
InChI key:InChIKey=CAJZQOSHWLRDIK-UHFFFAOYSA-N
SMILES:C(C=O)C1=CC(Br)=CC(Br)=C1
Synonyms:- Benzeneacetaldehyde, 3,5-dibromo-
- 3,5-Dibromobenzeneacetaldehyde
- 2-(3,5-Dibromophenyl)acetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.