CymitQuimica logo

CAS 1093468-95-1

:

2,5-di-(2-ethylhexyl)-3,6-bis-(5''-n-hexyl-[2,2',5',2'']terthiophen-5-yl)-pyrrolo[3,4-c]pyrrole-1,4-dione

Description:
2,5-di-(2-ethylhexyl)-3,6-bis-(5''-n-hexyl-[2,2',5',2'']terthiophen-5-yl)-pyrrolo[3,4-c]pyrrole-1,4-dione is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and extended conjugated systems. This substance features a pyrrolo[3,4-c]pyrrole core, known for its stability and electronic properties, making it of interest in organic electronics and materials science. The presence of long alkyl chains, such as 2-ethylhexyl and n-hexyl groups, enhances its solubility in organic solvents, which is advantageous for processing in various applications. The compound's terthiophene units contribute to its electronic properties, potentially allowing for effective charge transport, making it suitable for use in organic photovoltaic cells and organic field-effect transistors. Additionally, the compound's unique structure may impart specific optical properties, which can be exploited in light-harvesting applications. Overall, this substance exemplifies the intersection of organic chemistry and materials science, with potential applications in advanced electronic devices.
Formula:C58H72N2O2S6
InChI:InChI=1S/C58H72N2O2S6/c1-7-13-17-19-23-41-25-27-43(63-41)45-29-31-47(65-45)49-33-35-51(67-49)55-53-54(58(62)59(55)37-39(11-5)21-15-9-3)56(60(57(53)61)38-40(12-6)22-16-10-4)52-36-34-50(68-52)48-32-30-46(66-48)44-28-26-42(64-44)24-20-18-14-8-2/h25-36,39-40H,7-24,37-38H2,1-6H3
SMILES:CCCCCCc1ccc(c2ccc(c3ccc(c4c5c(c(c6ccc(c7ccc(c8ccc(CCCCCC)s8)s7)s6)n(CC(CC)CCCC)c5=O)c(=O)n4CC(CC)CCCC)s3)s2)s1
Synonyms:
  • 2,5-Bis(2-ethylhexyl)-3,6-bis(5''-hexyl[2,2':5',2''-terthiophen]-5-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
  • 2,5-Dioctyl-3,6-Bis-(5''-N-Hexyl-[2,2',5',2'']Terthiophen-5-Yl)-Pyrrolo[3,4-C]Pyrrole-1,4-Dione
  • Lt-S952
  • Smdppeh
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.