
CAS 109347-41-3
:2-Iodobenzeneacetaldehyde
Description:
2-Iodobenzeneacetaldehyde, also known as 2-(iodophenyl)acetaldehyde, is an organic compound characterized by the presence of both an aldehyde functional group and an iodo substituent on a benzene ring. Its molecular structure consists of a benzene ring substituted at the second position with an iodine atom and an acetaldehyde group (-CHO) attached to the first carbon of the ethyl side chain. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The iodine atom introduces unique properties, such as increased molecular weight and potential for further halogenation or coupling reactions. 2-Iodobenzeneacetaldehyde is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactivity and the presence of iodine.
Formula:C8H7IO
InChI:InChI=1S/C8H7IO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,6H,5H2
InChI key:InChIKey=ZMOIBLKIUKDUFP-UHFFFAOYSA-N
SMILES:C(C=O)C1=C(I)C=CC=C1
Synonyms:- 2-Iodobenzeneacetaldehyde
- 2-(2-Iodophenyl)acetaldehyde
- Benzeneacetaldehyde, 2-iodo-
- o-Iodophenylacetaldehyde
- (2-Iodophenyl)acetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.