
CAS 109347-44-6
:4-(Methylthio)benzeneacetaldehyde
Description:
4-(Methylthio)benzeneacetaldehyde, with the CAS number 109347-44-6, is an organic compound characterized by the presence of a benzene ring substituted with a methylthio group and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor, which can be reminiscent of certain sulfur-containing compounds. The methylthio group contributes to its reactivity and potential applications in organic synthesis and fragrance industries. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the aldehyde group. The compound can participate in various chemical reactions, including nucleophilic additions and oxidation, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted, as compounds containing sulfur can sometimes pose health risks or environmental concerns. Overall, 4-(Methylthio)benzeneacetaldehyde is an interesting compound with potential applications in both industrial and research settings.
Formula:C9H10OS
InChI:InChI=1S/C9H10OS/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,7H,6H2,1H3
InChI key:InChIKey=KYPNZBIRXXYZMV-UHFFFAOYSA-N
SMILES:C(C=O)C1=CC=C(SC)C=C1
Synonyms:- 2-[4-(Methylsulfanyl)phenyl]acetaldehyde
- (4-Methylsulfanyl-phenyl)-acetaldehyde
- Benzeneacetaldehyde, 4-(methylthio)-
- 4-(Methylthio)benzeneacetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.