CymitQuimica logo

CAS 109347-94-6

:

8-bromo-1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid

Description:
8-Bromo-1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid, with CAS number 109347-94-6, is a synthetic organic compound belonging to the class of quinolines. This compound features a bicyclic structure characterized by a quinoline core, which is further substituted with a bromine atom, a cyclopropyl group, and a fluorine atom, contributing to its unique chemical properties. The presence of a piperazine moiety enhances its potential for biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The carboxylic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the compound's structural complexity may lead to interesting interactions with biological targets, potentially impacting its pharmacokinetics and pharmacodynamics. Overall, this compound exemplifies the intricate design often found in drug development, where specific substitutions are made to optimize therapeutic efficacy and minimize side effects.
Formula:C17H17BrFN3O3
InChI:InChI=1/C17H17BrFN3O3/c18-13-14-10(7-12(19)15(13)21-5-3-20-4-6-21)16(23)11(17(24)25)8-22(14)9-1-2-9/h7-9,20H,1-6H2,(H,24,25)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • PD 163449

    CAS:
    PD 163449 is a bioactive molecule of 4-pyridone group that inhibits bacterial type IIA topoisomerase (DNA gyrase and topoisomerase IV).
    Formula:C17H17BrFN3O3
    Color and Shape:Solid
    Molecular weight:410.24