CAS 109348-94-9

ETHYL ([3-(METHYLTHIO)-1,2,4-THIADIAZOL-5-YLTHIO]METHYL) CYANOCARBONIMIDODITHIOATE

Description:

Ethyl ([3-(methylthio)-1,2,4-thiadiazol-5-ylthio]methyl) cyanocarbonimidodithioate, identified by CAS number 109348-94-9, is a chemical compound that belongs to the class of thiadiazoles and is characterized by the presence of multiple functional groups, including a thiadiazole ring and a cyanocarbonimidodithioate moiety. This compound typically exhibits properties associated with its thiol and thioether functionalities, which can influence its reactivity and solubility in various solvents. It may be utilized in agricultural applications, particularly as a pesticide or fungicide, due to its potential biological activity against pests and pathogens. The presence of the methylthio group enhances its lipophilicity, potentially improving its absorption and efficacy in biological systems. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and redox processes. Safety and handling precautions are essential when working with this compound, as with many chemicals, due to potential toxicity and environmental impact.

Formula: C₈H₁₀N₄S₅

InChI: InChI=1/C8H10N4S5/c1-3-14-7(10-4-9)15-5-16-8-11-6(13-2)12-17-8/h3,5H2,1-2H3/b10-7-

SMILES: CCS/C(=N/C#N)/SCSc1nc(ns1)SC

Synonyms:

• Ethyl {[3-(methylthio)-1,2,4-thiadiazol-5-