CAS 109358-48-7

N-[(1,1-Dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-argininamide

Description:

N-[(1,1-Dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-argininamide, with CAS number 109358-48-7, is a complex organic compound characterized by its multi-functional structure. It features a peptide backbone, incorporating amino acids such as glycine, lysine, and arginine, which contribute to its biological activity and potential therapeutic applications. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may be used as a protecting group in peptide synthesis, enhancing stability and solubility. Additionally, the incorporation of a benzopyran moiety indicates potential interactions with biological targets, possibly influencing its pharmacological properties. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Its complex structure also implies that it may require careful handling and characterization through techniques such as NMR, mass spectrometry, and chromatography for purity assessment and functional analysis. Overall, this compound represents a significant interest in medicinal chemistry and drug development.

Formula: C₂₉H₄₄N₈O₇

InChI: InChI=1S/C29H44N8O7/c1-17-14-24(39)43-22-15-18(10-11-19(17)22)35-25(40)21(9-7-13-33-27(31)32)37-26(41)20(8-5-6-12-30)36-23(38)16-34-28(42)44-29(2,3)4/h10-11,14-15,20-21H,5-9,12-13,16,30H2,1-4H3,(H,34,42)(H,35,40)(H,36,38)(H,37,41)(H4,31,32,33)/t20-,21-/m0/s1

InChI key: InChIKey=GCCXTNKNTDPTJQ-SFTDATJTSA-N

SMILES: CC=1C=2C(=CC(NC([C@@H](NC([C@@H](NC(CNC(OC(C)(C)C)=O)=O)CCCCN)=O)CCCNC(=N)N)=O)=CC2)OC(=O)C1

Synonyms:

• L-Argininamide, N-[(1,1-dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-
• T-BUTYLOXYCARBONYLGLYCYL-L-LYSYL-L-ARGININE 4-METHYLCOUMARYL-7-AMIDE
• N-[(1,1-Dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-argininamide

Boc-Gly-Lys-Arg-AMC

CAS: 109358-48-7

Boc-Gly-Lys-Arg-AMC is a peptide that is used as a research tool to study the interactions between proteins. It binds to ion channels, receptors, and ligands, and can be used to study protein interactions. It has been reported that Boc-Gly-Lys-Arg-AMC is an activator of acetylcholine receptor and nicotinic acetylcholine receptor. The specificity of this ligand for different ion channels is not known.

Formula: C₂₉H₄₄N₈O₇

Purity: Min. 95%

Molecular weight: 616.71 g/mol

Ref: 3D-MGK-3143-V