CAS 1093653-13-4

Piperidine, 4-[[4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxy group and a phenylmethyl substituent, contributing to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Additionally, the compound's characteristics, such as melting point, boiling point, and specific reactivity, would be influenced by the functional groups present and their arrangement. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.

Formula: C₁₉H₂₃NO·ClH

InChI: InChI=1S/C19H23NO.ClH/c1-2-4-16(5-3-1)14-17-6-8-19(9-7-17)21-15-18-10-12-20-13-11-18;/h1-9,18,20H,10-15H2;1H

InChI key: InChIKey=KTAHNYFCGACMDN-UHFFFAOYSA-N

SMILES: C(C1=CC=C(OCC2CCNCC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[[4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)