
CAS 1093653-14-5
:Piperidine, 4-[[2-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[[2-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a phenylmethyl group and a phenoxy group contributes to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as moderate to high lipophilicity due to the aromatic groups, which can influence its pharmacokinetics and interaction with biological targets. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is used. Additionally, the compound's potential applications could range from medicinal chemistry to research in neuropharmacology, given the role of piperidine derivatives in various therapeutic areas. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C19H23NO·ClH
InChI:InChI=1S/C19H23NO.ClH/c1-2-6-16(7-3-1)14-18-8-4-5-9-19(18)21-15-17-10-12-20-13-11-17;/h1-9,17,20H,10-15H2;1H
InChI key:InChIKey=OJAHMXNBNYNPGL-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=C(CC3=CC=CC=C3)C=CC=C2.Cl
Synonyms:- Piperidine, 4-[[2-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.