CAS 109371-18-8
:4-Chloro-2,3,5-trimethylpyridine
Description:
4-Chloro-2,3,5-trimethylpyridine, with the CAS number 109371-18-8, is a heterocyclic organic compound belonging to the pyridine family. It features a pyridine ring substituted with three methyl groups at the 2, 3, and 5 positions, and a chlorine atom at the 4 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits a characteristic aromatic odor and is soluble in organic solvents. The presence of the chlorine atom and multiple methyl groups contributes to its unique chemical reactivity and potential applications in organic synthesis, particularly in the production of agrochemicals and pharmaceuticals. Additionally, 4-chloro-2,3,5-trimethylpyridine may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a valuable intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H10ClN
InChI:InChI=1S/C8H10ClN/c1-5-4-10-7(3)6(2)8(5)9/h4H,1-3H3
InChI key:InChIKey=ZAUDMWUHIFBOES-UHFFFAOYSA-N
SMILES:CC=1C(Cl)=C(C)C=NC1C
Synonyms:- Pyridine, 4-chloro-2,3,5-trimethyl-
- 4-Chloro-2,3,5-trimethylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
