
CAS 1093758-72-5
:3′-Amino[1,1′-biphenyl]-4-carboxaldehyde
Description:
3′-Amino[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by the presence of an amino group and an aldehyde functional group attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical reactions. The amino group (-NH2) is typically a strong electron-donating group, which can influence the compound's reactivity and solubility in polar solvents. The carboxaldehyde group (-CHO) is a reactive functional group that can participate in condensation reactions and can be further transformed into other functional groups. This compound may exhibit properties such as fluorescence or photochemical activity, making it of interest in fields like organic synthesis, materials science, and medicinal chemistry. Its specific applications and behavior would depend on the context of its use, including potential roles in drug development or as an intermediate in the synthesis of more complex molecules. Safety data and handling precautions should be consulted due to the presence of reactive functional groups.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c14-13-3-1-2-12(8-13)11-6-4-10(9-15)5-7-11/h1-9H,14H2
InChI key:InChIKey=XSPCZIFQMMYTBH-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C2=CC=C(C=O)C=C2
Synonyms:- 3′-Amino[1,1′-biphenyl]-4-carboxaldehyde
- 3′-Aminobiphenyl-4-carbaldehyde
- [1,1′-Biphenyl]-4-carboxaldehyde, 3′-amino-
- 3′-Amino-biphenyl-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.