CymitQuimica logo

CAS 1093758-82-7

:

2,5-Difluoro-3-nitrotoluene

Description:
2,5-Difluoro-3-nitrotoluene is an aromatic compound characterized by the presence of two fluorine atoms and one nitro group attached to a toluene ring. Its molecular structure features a methyl group (–CH3) and functional groups that influence its chemical reactivity and physical properties. Typically, this compound appears as a yellow to brown solid and is known for its moderate solubility in organic solvents. The presence of fluorine atoms enhances its stability and alters its electronic properties, making it of interest in various chemical applications, including synthesis and materials science. The nitro group contributes to its reactivity, particularly in electrophilic substitution reactions. Safety data indicates that, like many nitro compounds, it may pose health risks, necessitating careful handling and storage. Overall, 2,5-Difluoro-3-nitrotoluene serves as a valuable intermediate in the synthesis of more complex chemical entities, particularly in the development of agrochemicals and pharmaceuticals.
Formula:C7H5F2NO2
InChI:InChI=1S/C7H5F2NO2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,1H3
InChI key:JPBHCSGGXITIHO-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1F)[N+](=O)[O-])F
Found 4 products.