CAS 1093758-88-3

5-Fluoro-α,β-dimethyl-4-pyrimidineethanol

Description:

5-Fluoro-α,β-dimethyl-4-pyrimidineethanol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a fluorine atom at the 5 position of the pyrimidine ring contributes to its unique reactivity and potential biological activity. The α,β-dimethyl substituents indicate that there are two methyl groups attached to the carbon chain adjacent to the hydroxyl group, which is characteristic of alcohols. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, influencing its solubility in polar solvents. The fluorine substitution may enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many pyrimidine derivatives, it may also exhibit antimicrobial or antiviral properties, warranting further investigation into its biological effects.

Formula: C₈H₁₁FN₂O

InChI: InChI=1S/C8H11FN2O/c1-5(6(2)12)8-7(9)3-10-4-11-8/h3-6,12H,1-2H3

InChI key: InChIKey=WADNCTPAGJLTDQ-UHFFFAOYSA-N

SMILES: C(C(C)O)(C)C=1C(F)=CN=CN1

Synonyms:

• 4-Pyrimidineethanol, 5-fluoro-α,β-dimethyl-
• 5-Fluoro-α,β-dimethyl-4-pyrimidineethanol