CAS 1093759-41-1
:Ethyl 3-amino-2-chloro-4-pyridinecarboxylate
Description:
Ethyl 3-amino-2-chloro-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethyl ester functional group, an amino group, and a chloro substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The chloro group can also serve as a leaving group in reactions, enhancing its utility in synthetic pathways. Ethyl 3-amino-2-chloro-4-pyridinecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability in various solvents can vary, influencing its practical applications. As with many pyridine derivatives, it may also display specific interactions with biological targets, which could be explored for therapeutic purposes. Proper handling and safety measures should be observed due to its chemical properties and potential hazards.
Formula:C8H9ClN2O2
InChI:InChI=1S/C8H9ClN2O2/c1-2-13-8(12)5-3-4-11-7(9)6(5)10/h3-4H,2,10H2,1H3
InChI key:InChIKey=SMOJNGJZSOWFKH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(N)=C(Cl)N=CC1
Synonyms:- Ethyl 3-amino-2-chloro-4-pyridinecarboxylate
- 4-Pyridinecarboxylic acid, 3-amino-2-chloro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
