CymitQuimica logo

CAS 1093759-65-9

:

1,1-Dimethylethyl 1H-indol-4-yl carbonate

Description:
1,1-Dimethylethyl 1H-indol-4-yl carbonate, identified by its CAS number 1093759-65-9, is an organic compound characterized by its unique structural features. It consists of an indole moiety, which is a bicyclic structure containing a fused benzene and pyrrole ring, substituted with a carbonate group. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its solubility and reactivity in various chemical environments. This compound may exhibit interesting biological activities due to the indole structure, which is known for its presence in many natural products and pharmaceuticals. Additionally, the carbonate functional group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. The stability and reactivity of this compound can be influenced by factors such as temperature, solvent, and the presence of catalysts. Overall, 1,1-Dimethylethyl 1H-indol-4-yl carbonate represents a significant compound for research in organic chemistry and potential applications in medicinal chemistry.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-13(2,3)17-12(15)16-11-6-4-5-10-9(11)7-8-14-10/h4-8,14H,1-3H3
InChI key:InChIKey=SVSODYSTAWACLJ-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C1=C2C(NC=C2)=CC=C1
Synonyms:
  • 1,1-Dimethylethyl 1H-indol-4-yl carbonate
  • Carbonic acid, 1,1-dimethylethyl 1H-indol-4-yl ester
  • tert-butyl 1H-indol-4-yl carbonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.