
CAS 109376-83-2
:ML 7
Description:
ML 7, with the CAS number 109376-83-2, is a chemical compound known primarily as a selective inhibitor of myosin light chain kinase (MLCK). This compound is often utilized in biochemical research to study cellular processes involving muscle contraction and cell motility, as MLCK plays a crucial role in phosphorylating myosin light chains, which is essential for muscle contraction. ML 7 is characterized by its ability to inhibit MLCK activity, thereby affecting various signaling pathways that depend on myosin phosphorylation. The compound is typically used in laboratory settings to investigate the effects of myosin inhibition on cellular functions, including migration, adhesion, and contraction. It is important to handle ML 7 with care, following appropriate safety protocols, as with any chemical reagent. Its specific solubility, stability, and reactivity can vary depending on the conditions of use, such as pH and temperature, making it essential to consult detailed material safety data sheets (MSDS) and relevant literature for comprehensive handling and application guidelines.
Formula:C15H17IN2O2S
InChI:InChI=1S/C15H17IN2O2S/c16-14-6-1-5-13-12(14)4-2-7-15(13)21(19,20)18-10-3-8-17-9-11-18/h1-2,4-7,17H,3,8-11H2
InChI key:InChIKey=GEHJIACZUFWBTK-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C2=C(C(I)=CC=C2)C=CC1)N3CCCNCC3
Synonyms:- ML 7
- 1H-1,4-Diazepine, hexahydro-1-[(5-iodo-1-naphthalenyl)sulfonyl]-
- Hexahydro-1-[(5-iodo-1-naphthalenyl)sulfonyl]-1H-1,4-diazepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ML 7
CAS:ML 7 is an inhibitor of myosin light chain kinase that protects cardiac function from ischemia/reperfusion (I/R) injury.Formula:C15H17IN2O2SColor and Shape:SolidMolecular weight:416.28
