CymitQuimica logo

CAS 109384-27-2

:

1-METHYL-PIPERAZIN-2-ONE HYDROCHLORIDE

Description:
1-Methyl-piperazin-2-one hydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group attached to the nitrogen atom at the first position and a carbonyl group at the second position of the piperazine ring. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various applications. The presence of the piperazine structure contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting central nervous system disorders. Its molecular structure allows for various modifications, which can influence its pharmacological properties. Safety data sheets and handling guidelines should be consulted for information regarding toxicity and safe handling practices, as with any chemical substance. Overall, 1-methyl-piperazin-2-one hydrochloride is a versatile compound with significant implications in medicinal chemistry.
Formula:C5H11ClN2O
InChI:InChI=1S/C5H10N2O.ClH/c1-7-3-2-6-4-5(7)8;/h6H,2-4H2,1H3;1H
InChI key:KMRWHESBJZFGFH-UHFFFAOYSA-N
SMILES:CN1CCNCC1=O.Cl
Found 4 products.