
CAS 1093878-33-1
:3-(4-Bromophenyl)-3-fluorooxetane
Description:
3-(4-Bromophenyl)-3-fluorooxetane is a synthetic organic compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of a bromophenyl group and a fluorine atom at the 3-position of the oxetane contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative bromine and fluorine substituents, which can influence its reactivity and solubility in various solvents. The bromine atom may also impart some degree of lipophilicity, making it potentially useful in medicinal chemistry and material science. Additionally, the oxetane ring can participate in various chemical reactions, such as ring-opening reactions, which can be exploited in synthetic pathways. Overall, 3-(4-Bromophenyl)-3-fluorooxetane represents a versatile structure with potential applications in pharmaceuticals and organic synthesis, although specific reactivity and stability would depend on the surrounding chemical environment and conditions.
Formula:C9H8BrFO
InChI:InChI=1S/C9H8BrFO/c10-8-3-1-7(2-4-8)9(11)5-12-6-9/h1-4H,5-6H2
InChI key:InChIKey=SQVOYDWWROMJHE-UHFFFAOYSA-N
SMILES:FC1(COC1)C2=CC=C(Br)C=C2
Synonyms:- Oxetane, 3-(4-bromophenyl)-3-fluoro-
- 3-(4-Bromophenyl)-3-fluorooxetane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.