CymitQuimica logo

CAS 1093879-47-0

:

2-Bromo-6-(2-methoxyethyl)pyridine

Description:
2-Bromo-6-(2-methoxyethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a 2-methoxyethyl group at the 6-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The methoxyethyl group enhances its reactivity and solubility, making it a valuable intermediate in organic synthesis, especially in the pharmaceutical and agrochemical industries. Additionally, the bromine atom can participate in nucleophilic substitution reactions, further expanding its utility in synthetic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-11-6-5-7-3-2-4-8(9)10-7/h2-4H,5-6H2,1H3
InChI key:InChIKey=MKPRHUMWXADVAI-UHFFFAOYSA-N
SMILES:C(COC)C=1N=C(Br)C=CC1
Synonyms:
  • 2-Bromo-6-(2-methoxyethyl)pyridine
  • Pyridine, 2-bromo-6-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.