CymitQuimica logo

CAS 1093881-55-0

:

B-[(1E)-3-Hydroxy-3-methyl-1-buten-1-yl]boronic acid

Description:
B-[(1E)-3-Hydroxy-3-methyl-1-buten-1-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a hydroxyalkene structure, specifically a 3-hydroxy-3-methyl-1-buten-1-yl moiety, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the hydroxy group enhances its solubility in polar solvents and may influence its biological activity. The compound's unique structure and functional groups suggest potential utility in the development of pharmaceuticals, agrochemicals, and materials science. As with many boronic acids, it may exhibit sensitivity to moisture and air, necessitating careful handling and storage conditions to maintain its stability and reactivity.
Formula:C5H11BO3
InChI:InChI=1S/C5H11BO3/c1-5(2,7)3-4-6(8)9/h3-4,7-9H,1-2H3/b4-3+
InChI key:InChIKey=BINKALPAZQLGCA-ONEGZZNKSA-N
SMILES:C(\C(C)(C)O)=C/B(O)O
Synonyms:
  • B-[(1E)-3-Hydroxy-3-methyl-1-buten-1-yl]boronic acid
  • Boronic acid, B-[(1E)-3-hydroxy-3-methyl-1-buten-1-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.