CAS 1093961-41-1
:B-(3-Methyl-1H-pyrazol-4-yl)boronic acid
Description:
B-(3-Methyl-1H-pyrazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under ambient conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the 3-methyl group on the pyrazole ring can influence its reactivity and solubility, as well as its interactions with biological targets. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug design. Overall, B-(3-Methyl-1H-pyrazol-4-yl)boronic acid is a versatile compound with significant utility in both synthetic and applied chemistry contexts.
Formula:C4H7BN2O2
InChI:InChI=1S/C4H7BN2O2/c1-3-4(5(8)9)2-6-7-3/h2,8-9H,1H3,(H,6,7)
InChI key:InChIKey=ZYXMOCKFGABUGK-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C)=NNC1
Synonyms:- 3-Methyl-1H-pyrazol-4-ylboronic acid
- (5-Methyl-1H-pyrazol-4-yl)boronic acid
- B-(3-Methyl-1H-pyrazol-4-yl)boronic acid
- Boronic acid, B-(3-methyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
