
CAS 1094070-47-9
:3-Iodo-6-methyl-8-(methylthio)imidazo[1,2-a]pyrazine
Description:
3-Iodo-6-methyl-8-(methylthio)imidazo[1,2-a]pyrazine is a heterocyclic compound characterized by its imidazo[1,2-a]pyrazine core, which features a fused ring system containing nitrogen atoms. The presence of an iodine atom at the 3-position and a methylthio group at the 8-position contributes to its unique chemical properties and potential biological activity. The methyl group at the 6-position enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its structural features suggest that it may exhibit interesting pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would be necessary to confirm such effects. The compound's stability, reactivity, and interactions with other molecules can be influenced by the presence of the iodine and methylthio substituents, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C8H8IN3S
InChI:InChI=1S/C8H8IN3S/c1-5-4-12-6(9)3-10-7(12)8(11-5)13-2/h3-4H,1-2H3
InChI key:InChIKey=OIWGXGZKQURZOM-UHFFFAOYSA-N
SMILES:S(C)C=1C=2N(C(I)=CN2)C=C(C)N1
Synonyms:- 3-Iodo-6-methyl-8-(methylsulfanyl)imidazo[1,2-a]pyrazine
- Imidazo[1,2-a]pyrazine, 3-iodo-6-methyl-8-(methylthio)-
- 3-Iodo-6-methyl-8-(methylthio)imidazo[1,2-a]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.