CymitQuimica logo

CAS 1094070-51-5

:

Methyl 5-amino-3-isothiazolecarboxylate

Description:
Methyl 5-amino-3-isothiazolecarboxylate is a chemical compound characterized by its isothiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the isothiazole ring, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylate group. The compound is of interest in medicinal chemistry and agricultural applications, particularly for its potential use in the synthesis of bioactive molecules. Its unique structure allows for various chemical modifications, which can enhance its pharmacological properties. Safety data and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, Methyl 5-amino-3-isothiazolecarboxylate represents a versatile scaffold for further chemical exploration and development.
Formula:C5H6N2O2S
InChI:InChI=1S/C5H6N2O2S/c1-9-5(8)3-2-4(6)10-7-3/h2H,6H2,1H3
InChI key:InChIKey=YRGYIZCDBMJMGM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(N)SN1
Synonyms:
  • Methyl 5-amino-3-isothiazolecarboxylate
  • 3-Isothiazolecarboxylic acid, 5-amino-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.