CymitQuimica logo

CAS 1094070-77-5

:

tert-butyl 2-bromothiazol-5-ylcarbamate

Description:
Tert-butyl 2-bromothiazol-5-ylcarbamate is a chemical compound characterized by its unique structural features, including a thiazole ring and a carbamate functional group. The presence of the bromine atom at the 2-position of the thiazole ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The tert-butyl group enhances the lipophilicity of the molecule, which can influence its biological activity and solubility in organic solvents. This compound may exhibit specific pharmacological properties, making it of interest in drug development and agrochemical research. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored in various studies. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal. Overall, tert-butyl 2-bromothiazol-5-ylcarbamate represents a versatile compound with potential applications in various fields of chemistry.
Formula:C8H11BrN2O2S
InChI:InChI=1S/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-5-4-10-6(9)14-5/h4H,1-3H3,(H,11,12)
InChI key:DXTQRJCFSNCPMD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=CN=C(S1)Br
Synonyms:
  • (2-Bromo-thiazol-5-yl)-carbamic acid tert-butyl ester
  • tert-butyl N-(2-bromo-1,3-thiazol-5-yl)carbamate
Found 4 products.