CAS 1094071-94-9

1-(Methylamino)cyclopropanemethanol

Description:

1-(Methylamino)cyclopropanemethanol is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a hydroxymethyl group attached to a methylamino substituent. This compound is classified as an amine due to the presence of the methylamino group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The cyclopropane ring contributes to the compound's rigidity and strain, affecting its chemical behavior and potential interactions with other molecules. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of both amine and alcohol functional groups suggests potential for diverse reactivity, including nucleophilic substitution and formation of various derivatives. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by the balance of hydrophobic and hydrophilic characteristics imparted by its functional groups. Overall, 1-(Methylamino)cyclopropanemethanol represents a fascinating subject for further study in organic synthesis and potential applications in drug development.

Formula: C₅H₁₁NO

InChI: InChI=1S/C5H11NO/c1-6-5(4-7)2-3-5/h6-7H,2-4H2,1H3

InChI key: InChIKey=HKFABBUJPSDLPI-UHFFFAOYSA-N

SMILES: C(O)C1(NC)CC1

Synonyms:

• 1-(Methylamino)cyclopropanemethanol
• Cyclopropanemethanol, 1-(methylamino)-
• [1-(Methylamino)cyclopropyl]methanol