CAS 1094072-07-7

4-(Ethylamino)tetrahydro-2H-pyran-4-methanol

Description:

4-(Ethylamino)tetrahydro-2H-pyran-4-methanol is an organic compound characterized by its tetrahydropyran structure, which features a six-membered ring containing one oxygen atom. The presence of an ethylamino group indicates that it has an amine functional group, contributing to its potential basicity and reactivity. The methanol moiety suggests that the compound has a hydroxyl (-OH) group, which can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit properties typical of both amines and alcohols, such as being polar and capable of forming hydrogen bonds with other molecules. Its molecular structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the potential biological activity associated with its functional groups. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it of interest in synthetic organic chemistry. As with any chemical substance, safety and handling precautions should be observed, given the potential hazards associated with amines and alcohols.

Formula: C₈H₁₇NO₂

InChI: InChI=1S/C8H17NO2/c1-2-9-8(7-10)3-5-11-6-4-8/h9-10H,2-7H2,1H3

InChI key: InChIKey=UWPYTQFSTIEVNQ-UHFFFAOYSA-N

SMILES: N(CC)C1(CO)CCOCC1

Synonyms:

• 2H-Pyran-4-methanol, 4-(ethylamino)tetrahydro-
• 4-(Ethylamino)tetrahydro-2H-pyran-4-methanol
• [4-(Ethylamino)oxan-4-yl]methanol