CAS 109412-11-5

2-Pyrrolidinone, 1-ethenyl-, trimer

Description:

2-Pyrrolidinone, 1-ethenyl-, trimer, with the CAS number 109412-11-5, is a chemical compound that belongs to the class of pyrrolidinones, which are cyclic amides. This substance is characterized by its trimeric structure, resulting from the polymerization of 1-vinyl-2-pyrrolidinone monomers. It typically exhibits properties such as being a colorless to pale yellow solid or viscous liquid, depending on its specific formulation and molecular weight. The compound is soluble in water and various organic solvents, making it versatile for different applications. It is often utilized in the production of polymers, coatings, and adhesives due to its ability to enhance film-forming properties and improve adhesion. Additionally, 2-Pyrrolidinone, 1-ethenyl-, trimer may have applications in the cosmetic and pharmaceutical industries, owing to its biocompatibility and potential as a stabilizing agent. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: (C₆H₉NO)₃

InChI: InChI=1S/C6H9NO/c1-2-7-5-3-4-6(7)8/h2H,1,3-5H2

InChI key: InChIKey=WHNWPMSKXPGLAX-UHFFFAOYSA-N

SMILES: C(=C)N1C(=O)CCC1

Synonyms:

• 2-Pyrrolidinone, 1-ethenyl-, trimer
• 2-Pyrrolidinone, 1-vinyl-, trimer

2-Pyrrolidinone, 1-ethenyl-, trimer

CAS: 109412-11-5

Formula: C₆H₉NO

Molecular weight: 111.1418

Ref: IN-DA01X3QV