CymitQuimica logo

CAS 1094217-64-7

:

3′-(Methylsulfonyl)[1,1′-biphenyl]-3-ol

Description:
3′-(Methylsulfonyl)[1,1′-biphenyl]-3-ol, identified by its CAS number 1094217-64-7, is an organic compound characterized by the presence of a biphenyl structure substituted with a hydroxyl group and a methylsulfonyl group. This compound typically exhibits properties associated with both aromatic compounds and alcohols, including potential solubility in organic solvents and moderate polarity due to the hydroxyl group. The methylsulfonyl group enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The compound's structure suggests it may participate in hydrogen bonding due to the hydroxyl group, which can affect its physical properties such as melting point and boiling point. Additionally, the biphenyl framework can contribute to its stability and electronic properties, potentially allowing for interactions with various biological targets. Overall, 3′-(Methylsulfonyl)[1,1′-biphenyl]-3-ol is a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C13H12O3S
InChI:InChI=1S/C13H12O3S/c1-17(15,16)13-7-3-5-11(9-13)10-4-2-6-12(14)8-10/h2-9,14H,1H3
InChI key:InChIKey=HIHRWLIGRIDMDL-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C=C(C=CC1)C2=CC(O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 3′-(methylsulfonyl)-
  • 3′-(Methylsulfonyl)[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.