CAS 1094218-31-1

1-[4-(Difluoromethoxy)phenyl]cyclopentanamine

Description:

1-[4-(Difluoromethoxy)phenyl]cyclopentanamine is a chemical compound characterized by its unique structure, which includes a cyclopentanamine moiety and a para-substituted difluoromethoxyphenyl group. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential basicity due to the amine functional group and hydrophobic characteristics from the aromatic ring. The presence of the difluoromethoxy group can influence its electronic properties, potentially enhancing lipophilicity and altering reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its fluorinated substituent may contribute to improved metabolic stability or bioavailability. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Safety and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities.

Formula: C₁₂H₁₅F₂NO

InChI: InChI=1S/C12H15F2NO/c13-11(14)16-10-5-3-9(4-6-10)12(15)7-1-2-8-12/h3-6,11H,1-2,7-8,15H2

InChI key: InChIKey=SNMAPNCSJUDMOW-UHFFFAOYSA-N

SMILES: NC1(CCCC1)C2=CC=C(OC(F)F)C=C2

Synonyms:

• Cyclopentanamine, 1-[4-(difluoromethoxy)phenyl]-
• 1-[4-(Difluoromethoxy)phenyl]cyclopentanamine