
CAS 1094218-38-8
:4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-amine
Description:
4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-amine, identified by its CAS number 1094218-38-8, is a chemical compound characterized by its unique structural features. It contains a tetrahydropyran ring, which is a six-membered cyclic ether, and an amine functional group, indicating potential basic properties. The presence of the 1,3-benzodioxole moiety contributes to its aromatic characteristics and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic component, while the amine group may enhance its solubility in polar solvents. The structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of both the aromatic and aliphatic components. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation through experimental studies. Overall, its unique structure positions it as a compound of interest in various chemical and biological research fields.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c13-12(3-5-14-6-4-12)9-1-2-10-11(7-9)16-8-15-10/h1-2,7H,3-6,8,13H2
InChI key:InChIKey=YATJMXJGGKOEIY-UHFFFAOYSA-N
SMILES:NC1(CCOCC1)C=2C=C3C(=CC2)OCO3
Synonyms:- 2H-Pyran-4-amine, 4-(1,3-benzodioxol-5-yl)tetrahydro-
- 4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.