CymitQuimica logo

CAS 1094219-13-2

:

4-[Methyl(1-methylethyl)amino]-2-pyridinecarboxylic acid

Description:
4-[Methyl(1-methylethyl)amino]-2-pyridinecarboxylic acid, identified by its CAS number 1094219-13-2, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a tertiary amine. This compound exhibits characteristics typical of pyridine derivatives, including potential basicity due to the nitrogen atom in the ring. The presence of the carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, influencing its solubility and reactivity. The methyl and isopropyl substituents on the nitrogen atom enhance its steric bulk, which may affect its interaction with biological targets or other chemical species. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its unique structure suggests potential applications in medicinal chemistry, where modifications to the pyridine and amine functionalities can lead to varied biological activities. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-7(2)12(3)8-4-5-11-9(6-8)10(13)14/h4-7H,1-3H3,(H,13,14)
InChI key:InChIKey=NLCBNFSDKYCRPK-UHFFFAOYSA-N
SMILES:N(C(C)C)(C)C=1C=C(C(O)=O)N=CC1
Synonyms:
  • 2-Pyridinecarboxylic acid, 4-[methyl(1-methylethyl)amino]-
  • 4-[Methyl(1-methylethyl)amino]-2-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.