CAS 1094219-65-4

2-(1H-1,2,4-Triazol-5-yl)-4-thiazoleacetic acid

Description:

2-(1H-1,2,4-Triazol-5-yl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a triazole ring and a thiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both acidic and basic functional groups. The triazole and thiazole rings contribute to its potential biological activity, making it of interest in pharmaceutical research, particularly for its possible antimicrobial or antifungal properties. The presence of the carboxylic acid group in the thiazoleacetic acid portion suggests that it can participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit specific interactions with biological targets due to its heterocyclic nature, which can influence its pharmacokinetic and pharmacodynamic profiles. Overall, 2-(1H-1,2,4-Triazol-5-yl)-4-thiazoleacetic acid represents a class of compounds that are valuable in medicinal chemistry and may have applications in drug development.

Formula: C₇H₆N₄O₂S

InChI: InChI=1S/C7H6N4O2S/c12-5(13)1-4-2-14-7(10-4)6-8-3-9-11-6/h2-3H,1H2,(H,12,13)(H,8,9,11)

InChI key: InChIKey=SANYHWBNPSXCQX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(SC1)C=2NC=NN2

Synonyms:

• 4-Thiazoleacetic acid, 2-(1H-1,2,4-triazol-5-yl)-
• 2-(1H-1,2,4-Triazol-5-yl)-4-thiazoleacetic acid

2-[2-(4H-1,2,4-Triazol-3-yl)-1,3-thiazol-4-yl]acetic acid

CAS: 1094219-65-4

Versatile small molecule scaffold

Formula: C₇H₆N₄O₂S

Purity: Min. 95%

Molecular weight: 210.22 g/mol

Ref: 3D-UTB21965