CymitQuimica logo

CAS 1094220-56-0

:

1-Cyclopropyl-α-(2-methylpropyl)-1H-benzimidazole-2-methanamine

Description:
1-Cyclopropyl-α-(2-methylpropyl)-1H-benzimidazole-2-methanamine is a chemical compound characterized by its unique structural features, which include a benzimidazole core, a cyclopropyl group, and an alkyl substituent. The presence of the benzimidazole moiety suggests potential biological activity, as this class of compounds is often associated with various pharmacological properties. The cyclopropyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the α-(2-methylpropyl) substituent may enhance lipophilicity, which can impact the compound's solubility and permeability. The compound's amine functional group indicates basicity, which may play a role in its interaction with receptors or enzymes. Overall, the combination of these structural elements suggests that 1-Cyclopropyl-α-(2-methylpropyl)-1H-benzimidazole-2-methanamine could exhibit interesting chemical behavior and potential applications in medicinal chemistry, although specific biological activity would require further investigation.
Formula:C15H21N3
InChI:InChI=1S/C15H21N3/c1-10(2)9-12(16)15-17-13-5-3-4-6-14(13)18(15)11-7-8-11/h3-6,10-12H,7-9,16H2,1-2H3
InChI key:InChIKey=LEORPYNWCOOJKN-UHFFFAOYSA-N
SMILES:C(CC(C)C)(N)C=1N(C=2C(N1)=CC=CC2)C3CC3
Synonyms:
  • 1H-Benzimidazole-2-methanamine, 1-cyclopropyl-α-(2-methylpropyl)-
  • 1-Cyclopropyl-α-(2-methylpropyl)-1H-benzimidazole-2-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.