CAS 1094226-46-6

2-(Chloromethyl)-5-(3-methoxyphenyl)oxazole

Description:

2-(Chloromethyl)-5-(3-methoxyphenyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chloromethyl group indicates that a chlorine atom is attached to a carbon that is also bonded to a methyl group, enhancing its reactivity and potential for further chemical modifications. The 3-methoxyphenyl substituent suggests the presence of a methoxy group (-OCH3) attached to a phenyl ring, which can influence the compound's solubility, polarity, and overall reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure allows for potential interactions with various biological targets, and the presence of halogen and methoxy groups can affect its pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chloromethyl group, which can be hazardous.

Formula: C₁₁H₁₀ClNO₂

InChI: InChI=1S/C11H10ClNO2/c1-14-9-4-2-3-8(5-9)10-7-13-11(6-12)15-10/h2-5,7H,6H2,1H3

InChI key: InChIKey=FDQKSUGLWHWEAK-UHFFFAOYSA-N

SMILES: C(Cl)C=1OC(=CN1)C2=CC(OC)=CC=C2

Synonyms:

• 2-(Chloromethyl)-5-(3-methoxyphenyl)oxazole
• 2-(Chloromethyl)-5-(3-methoxyphenyl)-1,3-oxazole
• Oxazole, 2-(chloromethyl)-5-(3-methoxyphenyl)-

2-(Chloromethyl)-5-(3-methoxyphenyl)-1,3-oxazole

CAS: 1094226-46-6

Versatile small molecule scaffold

Formula: C₁₁H₁₀ClNO₂

Purity: Min. 95%

Molecular weight: 223.65 g/mol

Ref: 3D-UTB22646