CymitQuimica logo

CAS 109425-56-1

:

1-(9H-Fluoren-9-ylmethyl) 5-oxo-1,2-pyrrolidinedicarboxylate

Description:
1-(9H-Fluoren-9-ylmethyl) 5-oxo-1,2-pyrrolidinedicarboxylate, with the CAS number 109425-56-1, is a chemical compound characterized by its unique structure that combines a fluorenylmethyl group with a pyrrolidine dicarboxylate moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its stability and reactivity. The presence of the fluorenyl group imparts significant hydrophobic characteristics, while the pyrrolidine ring introduces potential for various chemical transformations, including nucleophilic substitutions and cycloadditions. The dicarboxylate functionality suggests the potential for forming salts or esters, enhancing its versatility in synthetic applications. Additionally, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its solubility and reactivity can vary depending on the solvent and conditions, which is crucial for its application in organic synthesis and potential pharmaceutical development. Overall, this compound represents a fascinating intersection of structural complexity and functional potential in organic chemistry.
Formula:C20H17NO5
InChI:InChI=1S/C20H17NO5/c22-18-10-9-17(19(23)24)21(18)20(25)26-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,23,24)
InChI key:InChIKey=MLXGNRPYKJINKM-UHFFFAOYSA-N
SMILES:C(OC(=O)N1C(C(O)=O)CCC1=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 1-(9H-Fluoren-9-ylmethyl) 5-oxo-1,2-pyrrolidinedicarboxylate
  • 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(9H-fluoren-9-ylmethyl) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.