CAS 1094273-07-0

4-Bromo-2-(bromomethyl)-1-(difluoromethoxy)benzene

Description:

4-Bromo-2-(bromomethyl)-1-(difluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a difluoromethoxy group. The presence of multiple bromine substituents indicates that it is likely to exhibit significant reactivity, particularly in electrophilic aromatic substitution reactions. The difluoromethoxy group contributes to the compound's overall polarity and may influence its solubility in various solvents. This compound is typically used in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules. Its unique combination of halogen substituents can also impart specific physical properties, such as increased density and altered boiling and melting points compared to non-halogenated analogs. Safety considerations are important when handling this substance, as brominated compounds can be hazardous. Overall, 4-Bromo-2-(bromomethyl)-1-(difluoromethoxy)benzene is a valuable compound in the field of materials science and medicinal chemistry, where its reactivity and functional groups can be exploited for various applications.

Formula: C₈H₆Br₂F₂O

InChI: InChI=1S/C8H6Br2F2O/c9-4-5-3-6(10)1-2-7(5)13-8(11)12/h1-3,8H,4H2

InChI key: InChIKey=NLCDKWIZJYZHEX-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=C(CBr)C=C(Br)C=C1

Synonyms:

• Benzene, 4-bromo-2-(bromomethyl)-1-(difluoromethoxy)-
• 4-Bromo-2-(bromomethyl)-1-(difluoromethoxy)benzene