
CAS 1094291-17-4
:3-[(4-Fluorophenyl)methyl]-5-(2-pyrrolidinyl)-1,2,4-oxadiazole
Description:
3-[(4-Fluorophenyl)methyl]-5-(2-pyrrolidinyl)-1,2,4-oxadiazole is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The pyrrolidine moiety introduces a cyclic amine, which can affect the compound's pharmacokinetics and binding properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to modulate various biological pathways. Its molecular structure suggests it may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological activities would need to be confirmed through empirical studies. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in drug design and development. Overall, its unique structural features position it as a candidate for further research in therapeutic applications.
Formula:C13H14FN3O
InChI:InChI=1S/C13H14FN3O/c14-10-5-3-9(4-6-10)8-12-16-13(18-17-12)11-2-1-7-15-11/h3-6,11,15H,1-2,7-8H2
InChI key:InChIKey=IYILMVBHWCQFTO-UHFFFAOYSA-N
SMILES:C(C=1N=C(ON1)C2CCCN2)C3=CC=C(F)C=C3
Synonyms:- 3-[(4-Fluorophenyl)methyl]-5-(2-pyrrolidinyl)-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 3-[(4-fluorophenyl)methyl]-5-(2-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.