CymitQuimica logo

CAS 1094292-74-6

:

6-Chloro-3-[4-(1-methylethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazine

Description:
6-Chloro-3-[4-(1-methylethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridazine moiety. The presence of a chloro substituent and an isopropylphenyl group contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic groups, which can influence its solubility and bioavailability. The triazole and pyridazine rings may impart specific reactivity, making it a potential candidate for various chemical reactions or biological activities. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the presence of chlorine may enhance its reactivity or stability in certain conditions. Overall, the characteristics of this compound make it an interesting subject for further research in medicinal chemistry and related fields.
Formula:C14H13ClN4
InChI:InChI=1S/C14H13ClN4/c1-9(2)10-3-5-11(6-4-10)14-17-16-13-8-7-12(15)18-19(13)14/h3-9H,1-2H3
InChI key:InChIKey=QBZWMHSCHGDBRN-UHFFFAOYSA-N
SMILES:ClC1=NN2C(=NN=C2C=C1)C3=CC=C(C(C)C)C=C3
Synonyms:
  • 6-Chloro-3-[4-(1-methylethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazine
  • 1,2,4-Triazolo[4,3-b]pyridazine, 6-chloro-3-[4-(1-methylethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.