CymitQuimica logo

CAS 1094306-27-0

:

N-Butyl-4-chloro-2-pyridinecarboxamide

Description:
N-Butyl-4-chloro-2-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is substituted with a butyl group and a chloro group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amide functional group. The chloro substituent can influence its reactivity and biological activity, potentially making it a candidate for various applications in pharmaceuticals or agrochemicals. The presence of the pyridine ring suggests potential interactions with biological systems, as pyridine derivatives are often involved in medicinal chemistry. Additionally, the butyl group contributes to the hydrophobic character of the molecule, which can affect its partitioning behavior in biological systems. Overall, N-Butyl-4-chloro-2-pyridinecarboxamide is a compound of interest for its potential applications, and its specific characteristics can be further explored through experimental studies and computational modeling.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c1-2-3-5-13-10(14)9-7-8(11)4-6-12-9/h4,6-7H,2-3,5H2,1H3,(H,13,14)
InChI key:InChIKey=LPMYIHKYXVKABD-UHFFFAOYSA-N
SMILES:C(NCCCC)(=O)C1=CC(Cl)=CC=N1
Synonyms:
  • N-Butyl-4-chloro-2-pyridinecarboxamide
  • 2-Pyridinecarboxamide, N-butyl-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.