CAS 1094311-96-2

Methanone, (3,5-dichlorophenyl)(2,4-difluorophenyl)-

Description:

Methanone, (3,5-dichlorophenyl)(2,4-difluorophenyl)-, also known by its CAS number 1094311-96-2, is an organic compound characterized by its ketone functional group, specifically a methanone structure. This compound features two aromatic rings: one containing two chlorine substituents at the 3 and 5 positions, and the other containing two fluorine substituents at the 2 and 4 positions. The presence of these halogen atoms significantly influences the compound's chemical properties, including its reactivity, polarity, and potential biological activity. The dichlorophenyl and difluorophenyl groups contribute to the compound's overall stability and may affect its solubility in various solvents. Additionally, the presence of halogens can enhance the compound's lipophilicity, making it of interest in pharmaceutical and agrochemical applications. Overall, this compound exemplifies the diverse nature of substituted aromatic ketones and their potential utility in various chemical contexts.

Formula: C₁₃H₆Cl₂F₂O

InChI: InChI=1S/C13H6Cl2F2O/c14-8-3-7(4-9(15)5-8)13(18)11-2-1-10(16)6-12(11)17/h1-6H

InChI key: InChIKey=ZPJQRYVPNNISIW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• Methanone, (3,5-dichlorophenyl)(2,4-difluorophenyl)-
• 3,5-Dichloro-2′,4′-difluorobenzophenone