CAS 1094318-24-7

5-(3-Chloro-4-fluorophenyl)-2-(chloromethyl)oxazole

Description:

5-(3-Chloro-4-fluorophenyl)-2-(chloromethyl)oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chloromethyl group and a chloro-fluorophenyl substituent contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit biological activity due to the presence of halogen substituents, which can influence its interaction with biological targets. The chloromethyl group can serve as a reactive site for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's molecular structure suggests potential lipophilicity, which may affect its solubility and permeability in biological systems. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application. Overall, 5-(3-Chloro-4-fluorophenyl)-2-(chloromethyl)oxazole represents a class of compounds that may be of interest in drug discovery and development.

Formula: C₁₀H₆Cl₂FNO

InChI: InChI=1S/C10H6Cl2FNO/c11-4-10-14-5-9(15-10)6-1-2-8(13)7(12)3-6/h1-3,5H,4H2

InChI key: InChIKey=OCLRLPKGCVJDNG-UHFFFAOYSA-N

SMILES: C(Cl)C=1OC(=CN1)C2=CC(Cl)=C(F)C=C2

Synonyms:

• 5-(3-Chloro-4-fluorophenyl)-2-(chloromethyl)-1,3-oxazole
• 5-(3-Chloro-4-fluorophenyl)-2-(chloromethyl)oxazole
• Oxazole, 5-(3-chloro-4-fluorophenyl)-2-(chloromethyl)-