CAS 1094325-06-0

Benzoic acid, 2-(3-pyridinyloxy)-

Description:

Benzoic acid, 2-(3-pyridinyloxy)-, also known by its CAS number 1094325-06-0, is an organic compound characterized by the presence of a benzoic acid moiety and a pyridine ring. This compound features a hydroxyl group attached to the pyridine, which enhances its solubility in polar solvents. It typically exhibits moderate acidity due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the pyridine ring can impart unique biological activities, making it of interest in pharmaceutical research. Additionally, the compound may exhibit properties such as antimicrobial or anti-inflammatory effects, depending on its specific structure and substituents. Its molecular structure suggests potential applications in agrochemicals, pharmaceuticals, and as a building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₉NO₃

InChI: InChI=1S/C12H9NO3/c14-12(15)10-5-1-2-6-11(10)16-9-4-3-7-13-8-9/h1-8H,(H,14,15)

InChI key: InChIKey=CVDCJGITZQGDJF-UHFFFAOYSA-N

SMILES: O(C1=C(C(O)=O)C=CC=C1)C=2C=CC=NC2

Synonyms:

• Benzoic acid, 2-(3-pyridinyloxy)-
• 2-(Pyridin-3-yloxy)benzoic acid

2-(Pyridin-3-yloxy)benzoic acid

CAS: 1094325-06-0

Versatile small molecule scaffold

Formula: C₁₂H₉NO₃

Purity: Min. 95%

Molecular weight: 215.2 g/mol

Ref: 3D-UTB32506