CAS 1094325-07-1

2-(3-Pyridinyloxy)benzenemethanol

Description:

2-(3-Pyridinyloxy)benzenemethanol, identified by its CAS number 1094325-07-1, is an organic compound characterized by the presence of both a pyridine and a phenolic structure. This compound features a pyridinyloxy group attached to a benzyl alcohol moiety, which contributes to its potential as a versatile building block in organic synthesis. The presence of the hydroxyl (-OH) group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature exhibit moderate polarity, making them soluble in polar solvents while retaining some hydrophobic characteristics due to the aromatic rings. Additionally, the pyridine ring can engage in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions, enhancing its utility in medicinal chemistry and material science. The compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of biologically active molecules, due to the ability of both the pyridine and phenolic components to interact with biological targets.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1S/C12H11NO2/c14-9-10-4-1-2-6-12(10)15-11-5-3-7-13-8-11/h1-8,14H,9H2

InChI key: InChIKey=FLSSCQCRCIJTOR-UHFFFAOYSA-N

SMILES: O(C1=C(CO)C=CC=C1)C=2C=CC=NC2

Synonyms:

• 2-(3-Pyridinyloxy)benzenemethanol
• Benzenemethanol, 2-(3-pyridinyloxy)-

[2-(Pyridin-3-yloxy)phenyl]methanol

CAS: 1094325-07-1

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO₂

Purity: Min. 95%

Molecular weight: 201.22 g/mol

Ref: 3D-UTB32507