CymitQuimica logo

CAS 1094325-90-2

:

3-(2-Methylphenyl)-2-thiophenecarboxylic acid

Description:
3-(2-Methylphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a carboxylic acid functional group. The presence of the 2-methylphenyl substituent contributes to its aromatic properties, enhancing its stability and potentially influencing its reactivity. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while the carboxylic acid group may impart some degree of polarity, allowing for hydrogen bonding interactions. It may also display acidic behavior, typical of carboxylic acids, which can participate in various chemical reactions, such as esterification or amidation. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions with other substances. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C12H10O2S
InChI:InChI=1S/C12H10O2S/c1-8-4-2-3-5-9(8)10-6-7-15-11(10)12(13)14/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=HTIUDBOQESCMPU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CS1)C2=C(C)C=CC=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 3-(2-methylphenyl)-
  • 3-(2-Methylphenyl)-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.