
CAS 1094336-64-7
:6-Bromo-1-(2-chloroethyl)-1H-indole-2,3-dione
Description:
6-Bromo-1-(2-chloroethyl)-1H-indole-2,3-dione is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a chloroethyl group at the 1-position contributes to its reactivity and potential biological activity. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The chloroethyl substituent may enhance its ability to interact with biological targets, making it of interest in medicinal chemistry. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anticancer or antimicrobial properties. However, specific safety and handling guidelines should be followed due to the presence of halogenated groups, which can pose environmental and health risks. As with many synthetic compounds, further research is necessary to fully understand its properties and potential applications.
Formula:C10H7BrClNO2
InChI:InChI=1S/C10H7BrClNO2/c11-6-1-2-7-8(5-6)13(4-3-12)10(15)9(7)14/h1-2,5H,3-4H2
InChI key:InChIKey=DOODITLQMSRDMF-UHFFFAOYSA-N
SMILES:C(CCl)N1C=2C(C(=O)C1=O)=CC=C(Br)C2
Synonyms:- 1H-Indole-2,3-dione, 6-bromo-1-(2-chloroethyl)-
- 6-Bromo-1-(2-chloroethyl)-1H-indole-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.