CymitQuimica logo

CAS 1094347-64-4

:

5-Ethyl-4-methyl-1H-pyrazole-3-carboxylic acid

Description:
5-Ethyl-4-methyl-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group as substituents on the pyrazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group (-COOH) at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The compound's molecular structure allows for potential interactions with biological systems, which may be of interest in pharmaceutical applications. Additionally, its solubility in polar solvents is influenced by the carboxylic acid group, while the hydrophobic ethyl and methyl groups may affect its overall lipophilicity. Overall, 5-Ethyl-4-methyl-1H-pyrazole-3-carboxylic acid exhibits characteristics typical of pyrazole derivatives, making it a subject of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-3-5-4(2)6(7(10)11)9-8-5/h3H2,1-2H3,(H,8,9)(H,10,11)
InChI key:InChIKey=MFNJGDMJKJLUGC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C)=C(CC)NN1
Synonyms:
  • 5-Ethyl-4-methyl-1H-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 5-ethyl-4-methyl-
  • 5-Ethyl-4-methyl-2H-pyrazole-3-carboxylic acid
  • 3-Ethyl-4-methyl-1H-pyrazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.